C28H31N5O7S — CID 67193429
6-[4-[(4-methoxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 67193429) has the molecular formula C28H31N5O7S and a molecular weight of 581.65 g/mol. Its IUPAC name is 6-[4-[(4-methoxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[4-[(4-methoxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 67193429 |
| Molecular Formula | C28H31N5O7S |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 6-[4-[(4-methoxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | COC1CCC(CNc2ccc(S(=O)(=O)C3(Oc4cnc5[nH]ccc5c4)C=CC=CC3C(N)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C28H31N5O7S/c1-39-20-7-5-18(6-8-20)16-31-24-10-9-22(15-25(24)33(35)36)41(37,38)28(12-3-2-4-23(28)26(29)34)40-21-14-19-11-13-30-27(19)32-17-21/h2-4,9-15,17-18,20,23,31H,5-8,16H2,1H3,(H2,29,34)(H,30,32) |
| InChIKey | SYAHDGHJTKBNNY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 179.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|