C29H28N6O6S — CID 175767748
N-[4-[(4-cyano-4-methylcyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 175767748) has the molecular formula C29H28N6O6S and a molecular weight of 588.65 g/mol. Its IUPAC name is N-[4-[(4-cyano-4-methylcyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[4-[(4-cyano-4-methylcyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 175767748 |
| Molecular Formula | C29H28N6O6S |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | N-[4-[(4-cyano-4-methylcyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | CC1(C#N)CCC(CNc2ccc(S(=O)(=O)NC(=O)c3ccccc3Oc3cnc4[nH]ccc4c3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H28N6O6S/c1-29(18-30)11-8-19(9-12-29)16-32-24-7-6-22(15-25(24)35(37)38)42(39,40)34-28(36)23-4-2-3-5-26(23)41-21-14-20-10-13-31-27(20)33-17-21/h2-7,10,13-15,17,19,32H,8-9,11-12,16H2,1H3,(H,31,33)(H,34,36) |
| InChIKey | JUHMCLGIESFCCA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 180.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|