C29H31N5O7S — CID 175767694
N-[4-[(4-ethyl-4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 175767694) has the molecular formula C29H31N5O7S and a molecular weight of 593.66 g/mol. Its IUPAC name is N-[4-[(4-ethyl-4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[4-[(4-ethyl-4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 175767694 |
| Molecular Formula | C29H31N5O7S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | N-[4-[(4-ethyl-4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | CCC1(O)CCC(CNc2ccc(S(=O)(=O)NC(=O)c3ccccc3Oc3cnc4[nH]ccc4c3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H31N5O7S/c1-2-29(36)12-9-19(10-13-29)17-31-24-8-7-22(16-25(24)34(37)38)42(39,40)33-28(35)23-5-3-4-6-26(23)41-21-15-20-11-14-30-27(20)32-18-21/h3-8,11,14-16,18-19,31,36H,2,9-10,12-13,17H2,1H3,(H,30,32)(H,33,35) |
| InChIKey | BCQTUWLFOUSDBM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 176.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|