C30H34N6O9S — CID 67513623
N-[4-[[4-[2-(2-methoxyethoxy)ethyl]morpholin-2-yl]methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 67513623) has the molecular formula C30H34N6O9S and a molecular weight of 654.70 g/mol. Its IUPAC name is N-[4-[[4-[2-(2-methoxyethoxy)ethyl]morpholin-2-yl]methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[4-[[4-[2-(2-methoxyethoxy)ethyl]morpholin-2-yl]methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 67513623 |
| Molecular Formula | C30H34N6O9S |
| Molecular Weight | 654.70 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | N-[4-[[4-[2-(2-methoxyethoxy)ethyl]morpholin-2-yl]methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | COCCOCCN1CCOC(CNc2ccc(S(=O)(=O)NC(=O)c3ccccc3Oc3cnc4[nH]ccc4c3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C30H34N6O9S/c1-42-14-15-43-12-10-35-11-13-44-23(20-35)19-32-26-7-6-24(17-27(26)36(38)39)46(40,41)34-30(37)25-4-2-3-5-28(25)45-22-16-21-8-9-31-29(21)33-18-22/h2-9,16-18,23,32H,10-15,19-20H2,1H3,(H,31,33)(H,34,37) |
| InChIKey | PUVCJWUSIPJVKD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|