C25H21F2N5O6S — CID 154465470
3-[4-[(3,3-difluorocyclobutyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 154465470) has the molecular formula C25H21F2N5O6S and a molecular weight of 557.54 g/mol. Its IUPAC name is 3-[4-[(3,3-difluorocyclobutyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | 3-[4-[(3,3-difluorocyclobutyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 154465470 |
| Molecular Formula | C25H21F2N5O6S |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 3-[4-[(3,3-difluorocyclobutyl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | NC(=O)c1cccc(S(=O)(=O)c2ccc(NCC3CC(F)(F)C3)c([N+](=O)[O-])c2)c1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C25H21F2N5O6S/c26-25(27)10-14(11-25)12-30-19-5-4-17(9-20(19)32(34)35)39(36,37)21-3-1-2-18(23(28)33)22(21)38-16-8-15-6-7-29-24(15)31-13-16/h1-9,13-14,30H,10-12H2,(H2,28,33)(H,29,31) |
| InChIKey | DEJCWGWGGKABSW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 170.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|