C26H27N5O7S — CID 67193974
3-[4-[(3-methoxy-2,2-dimethylpropyl)amino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 67193974) has the molecular formula C26H27N5O7S and a molecular weight of 553.60 g/mol. Its IUPAC name is 3-[4-[(3-methoxy-2,2-dimethylpropyl)amino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | 3-[4-[(3-methoxy-2,2-dimethylpropyl)amino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 67193974 |
| Molecular Formula | C26H27N5O7S |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 3-[4-[(3-methoxy-2,2-dimethylpropyl)amino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | COCC(C)(C)CNc1ccc(S(=O)(=O)c2cccc(C(N)=O)c2Oc2cnc3[nH]ccc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N5O7S/c1-26(2,15-37-3)14-30-20-8-7-18(12-21(20)31(33)34)39(35,36)22-6-4-5-19(24(27)32)23(22)38-17-11-16-9-10-28-25(16)29-13-17/h4-13,30H,14-15H2,1-3H3,(H2,27,32)(H,28,29) |
| InChIKey | PAFYGNJOIIPBFG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 179.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|