C19H19N5O6S — CID 157028371
N'-(3-morpholin-4-yl-4-nitrophenyl)sulfonyl-1H-indole-4-carbohydrazide (PubChem CID 157028371) has the molecular formula C19H19N5O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is N'-(3-morpholin-4-yl-4-nitrophenyl)sulfonyl-1H-indole-4-carbohydrazide.
| Compound Name | N'-(3-morpholin-4-yl-4-nitrophenyl)sulfonyl-1H-indole-4-carbohydrazide |
|---|---|
| PubChem CID | 157028371 |
| Molecular Formula | C19H19N5O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N'-(3-morpholin-4-yl-4-nitrophenyl)sulfonyl-1H-indole-4-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc([N+](=O)[O-])c(N2CCOCC2)c1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C19H19N5O6S/c25-19(15-2-1-3-16-14(15)6-7-20-16)21-22-31(28,29)13-4-5-17(24(26)27)18(12-13)23-8-10-30-11-9-23/h1-7,12,20,22H,8-11H2,(H,21,25) |
| InChIKey | WMAAXDBIZQVJDU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|