C11H11N3O7 — CID 141481199
5-morpholin-4-yl-2,4-dinitrobenzoic acid (PubChem CID 141481199) has the molecular formula C11H11N3O7 and a molecular weight of 297.22 g/mol. Its IUPAC name is 5-morpholin-4-yl-2,4-dinitrobenzoic acid.
| Compound Name | 5-morpholin-4-yl-2,4-dinitrobenzoic acid |
|---|---|
| PubChem CID | 141481199 |
| Molecular Formula | C11H11N3O7 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-morpholin-4-yl-2,4-dinitrobenzoic acid |
| SMILES | O=C(O)c1cc(N2CCOCC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O7/c15-11(16)7-5-9(12-1-3-21-4-2-12)10(14(19)20)6-8(7)13(17)18/h5-6H,1-4H2,(H,15,16) |
| InChIKey | GDDLDLWSBJTSNF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|