C14H17N3O8 — CID 155536771
(5-morpholin-4-yl-2,4-dinitrophenyl) 3-methoxypropanoate (PubChem CID 155536771) has the molecular formula C14H17N3O8 and a molecular weight of 355.30 g/mol. Its IUPAC name is (5-morpholin-4-yl-2,4-dinitrophenyl) 3-methoxypropanoate.
| Compound Name | (5-morpholin-4-yl-2,4-dinitrophenyl) 3-methoxypropanoate |
|---|---|
| PubChem CID | 155536771 |
| Molecular Formula | C14H17N3O8 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (5-morpholin-4-yl-2,4-dinitrophenyl) 3-methoxypropanoate |
| SMILES | COCCC(=O)Oc1cc(N2CCOCC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O8/c1-23-5-2-14(18)25-13-9-10(15-3-6-24-7-4-15)11(16(19)20)8-12(13)17(21)22/h8-9H,2-7H2,1H3 |
| InChIKey | XXQBJHLTZZBFNC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|