C17H22N2O7 — CID 4791635
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 4791635) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 4791635 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H22N2O7/c1-17(2,3)26-15(20)11-25-16(21)12-4-5-13(14(10-12)19(22)23)18-6-8-24-9-7-18/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | SATSZZPKUVPCMN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|