C20H18N2O8 — CID 7780819
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 7780819) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7780819 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18N2O8/c23-17(13-2-4-18-19(10-13)30-12-29-18)11-28-20(24)14-1-3-15(16(9-14)22(25)26)21-5-7-27-8-6-21/h1-4,9-10H,5-8,11-12H2 |
| InChIKey | ZXGXZWFBLUJGID-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|