C19H16Cl2N2O6 — CID 42982960
[2-(3,4-dichlorophenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 42982960) has the molecular formula C19H16Cl2N2O6 and a molecular weight of 439.25 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 42982960 |
| Molecular Formula | C19H16Cl2N2O6 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N2O6/c20-14-3-1-12(9-15(14)21)18(24)11-29-19(25)13-2-4-16(17(10-13)23(26)27)22-5-7-28-8-6-22/h1-4,9-10H,5-8,11H2 |
| InChIKey | RRVDXURSZMXJAP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|