C21H18ClN3O6 — CID 16605188
[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 16605188) has the molecular formula C21H18ClN3O6 and a molecular weight of 443.84 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 16605188 |
| Molecular Formula | C21H18ClN3O6 |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | O=C(OCc1cc(-c2ccc(Cl)cc2)no1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18ClN3O6/c22-16-4-1-14(2-5-16)18-12-17(31-23-18)13-30-21(26)15-3-6-19(20(11-15)25(27)28)24-7-9-29-10-8-24/h1-6,11-12H,7-10,13H2 |
| InChIKey | QUQSYEWTYJUBQH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 107.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|