C23H21ClN4O5 — CID 108726982
[3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 108726982) has the molecular formula C23H21ClN4O5 and a molecular weight of 468.90 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108726982 |
| Molecular Formula | C23H21ClN4O5 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)N1CCc2noc(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C23H21ClN4O5/c24-17-4-1-15(2-5-17)22-18-14-27(8-7-19(18)25-33-22)23(29)16-3-6-20(21(13-16)28(30)31)26-9-11-32-12-10-26/h1-6,13H,7-12,14H2 |
| InChIKey | BHAYWMVTRXGXSX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|