C19H13ClFN3O4 — CID 108743375
(4-chloro-2-nitrophenyl)-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 108743375) has the molecular formula C19H13ClFN3O4 and a molecular weight of 401.78 g/mol. Its IUPAC name is (4-chloro-2-nitrophenyl)-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | (4-chloro-2-nitrophenyl)-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 108743375 |
| Molecular Formula | C19H13ClFN3O4 |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (4-chloro-2-nitrophenyl)-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1[N+](=O)[O-])N1CCc2c(noc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H13ClFN3O4/c20-12-3-6-15(17(9-12)24(26)27)19(25)23-8-7-14-16(10-23)22-28-18(14)11-1-4-13(21)5-2-11/h1-6,9H,7-8,10H2 |
| InChIKey | AKZITRKBIYWGON-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|