C19H14FN3O4 — CID 108765596
[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(4-nitrophenyl)methanone (PubChem CID 108765596) has the molecular formula C19H14FN3O4 and a molecular weight of 367.34 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(4-nitrophenyl)methanone.
| Compound Name | [3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108765596 |
| Molecular Formula | C19H14FN3O4 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCc2c(noc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H14FN3O4/c20-14-5-1-12(2-6-14)18-16-9-10-22(11-17(16)21-27-18)19(24)13-3-7-15(8-4-13)23(25)26/h1-8H,9-11H2 |
| InChIKey | AESGDFOMKZXUBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|