C21H19FN4O4 — CID 108743251
[4-(dimethylamino)-3-nitrophenyl]-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 108743251) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is [4-(dimethylamino)-3-nitrophenyl]-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | [4-(dimethylamino)-3-nitrophenyl]-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 108743251 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [4-(dimethylamino)-3-nitrophenyl]-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | CN(C)c1ccc(C(=O)N2CCc3c(noc3-c3ccc(F)cc3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19FN4O4/c1-24(2)18-8-5-14(11-19(18)26(28)29)21(27)25-10-9-16-17(12-25)23-30-20(16)13-3-6-15(22)7-4-13/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | RPPSCNVRCVSBAD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|