C22H19FN2O5 — CID 108765581
ethyl [4-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine-6-carbonyl]phenyl] carbonate (PubChem CID 108765581) has the molecular formula C22H19FN2O5 and a molecular weight of 410.40 g/mol. Its IUPAC name is ethyl [4-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine-6-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine-6-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108765581 |
| Molecular Formula | C22H19FN2O5 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl [4-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine-6-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCc3c(noc3-c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C22H19FN2O5/c1-2-28-22(27)29-17-9-5-15(6-10-17)21(26)25-12-11-18-19(13-25)24-30-20(18)14-3-7-16(23)8-4-14/h3-10H,2,11-13H2,1H3 |
| InChIKey | GPSZRLLBZONTJX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|