C14H12ClFN2O2 — CID 108743296
2-chloro-1-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]ethanone (PubChem CID 108743296) has the molecular formula C14H12ClFN2O2 and a molecular weight of 294.71 g/mol. Its IUPAC name is 2-chloro-1-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]ethanone.
| Compound Name | 2-chloro-1-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 108743296 |
| Molecular Formula | C14H12ClFN2O2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-chloro-1-[3-(4-fluorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]ethanone |
| SMILES | O=C(CCl)N1CCc2c(noc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H12ClFN2O2/c15-7-13(19)18-6-5-11-12(8-18)17-20-14(11)9-1-3-10(16)4-2-9/h1-4H,5-8H2 |
| InChIKey | KFVASWBDKDXDRL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|