C21H16FN3O4 — CID 108727115
(E)-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 108727115) has the molecular formula C21H16FN3O4 and a molecular weight of 393.37 g/mol. Its IUPAC name is (E)-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 108727115 |
| Molecular Formula | C21H16FN3O4 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (E)-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N1CCc2noc(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C21H16FN3O4/c22-16-6-4-15(5-7-16)21-18-13-24(12-11-19(18)23-29-21)20(26)10-3-14-1-8-17(9-2-14)25(27)28/h1-10H,11-13H2/b10-3+ |
| InChIKey | RFAMNOQOHBTRKP-XCVCLJGOSA-N |
| XLogP | 3.99 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|