C20H16ClN3O5 — CID 108727085
1-[3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(4-nitrophenoxy)ethanone (PubChem CID 108727085) has the molecular formula C20H16ClN3O5 and a molecular weight of 413.82 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(4-nitrophenoxy)ethanone.
| Compound Name | 1-[3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 108727085 |
| Molecular Formula | C20H16ClN3O5 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(4-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N1CCc2noc(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C20H16ClN3O5/c21-14-3-1-13(2-4-14)20-17-11-23(10-9-18(17)22-29-20)19(25)12-28-16-7-5-15(6-8-16)24(26)27/h1-8H,9-12H2 |
| InChIKey | ZHYAZYYOMKUTSH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|