C24H19FN4O6 — CID 108727151
2-[4-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione (PubChem CID 108727151) has the molecular formula C24H19FN4O6 and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-[4-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[4-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108727151 |
| Molecular Formula | C24H19FN4O6 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-[4-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)N1CCc2noc(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C24H19FN4O6/c25-15-5-3-14(4-6-15)22-19-13-27(11-9-20(19)26-35-22)21(30)2-1-10-28-23(31)17-8-7-16(29(33)34)12-18(17)24(28)32/h3-8,12H,1-2,9-11,13H2 |
| InChIKey | RZYHLPKGZJJCMI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|