C26H24ClN3O4 — CID 108765779
2-[6-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-6-oxohexyl]isoindole-1,3-dione (PubChem CID 108765779) has the molecular formula C26H24ClN3O4 and a molecular weight of 477.95 g/mol. Its IUPAC name is 2-[6-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-6-oxohexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-6-oxohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108765779 |
| Molecular Formula | C26H24ClN3O4 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[6-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-6-oxohexyl]isoindole-1,3-dione |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)N1CCc2c(noc2-c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H24ClN3O4/c27-18-11-9-17(10-12-18)24-21-13-15-29(16-22(21)28-34-24)23(31)8-2-1-5-14-30-25(32)19-6-3-4-7-20(19)26(30)33/h3-4,6-7,9-12H,1-2,5,8,13-16H2 |
| InChIKey | NFPFNWKXWZMWPF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|