C19H12Cl4N2O2 — CID 108743393
[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(2,3,6-trichlorophenyl)methanone (PubChem CID 108743393) has the molecular formula C19H12Cl4N2O2 and a molecular weight of 442.13 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(2,3,6-trichlorophenyl)methanone.
| Compound Name | [3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(2,3,6-trichlorophenyl)methanone |
|---|---|
| PubChem CID | 108743393 |
| Molecular Formula | C19H12Cl4N2O2 |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | [3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-(2,3,6-trichlorophenyl)methanone |
| SMILES | O=C(c1c(Cl)ccc(Cl)c1Cl)N1CCc2c(noc2-c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H12Cl4N2O2/c20-11-3-1-10(2-4-11)18-12-7-8-25(9-15(12)24-27-18)19(26)16-13(21)5-6-14(22)17(16)23/h1-6H,7-9H2 |
| InChIKey | NDXNFIXVPWAIGX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|