C15H14ClFN2O2 — CID 108727198
2-chloro-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]propan-1-one (PubChem CID 108727198) has the molecular formula C15H14ClFN2O2 and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-chloro-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]propan-1-one.
| Compound Name | 2-chloro-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 108727198 |
| Molecular Formula | C15H14ClFN2O2 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-chloro-1-[3-(4-fluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CCc2noc(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C15H14ClFN2O2/c1-9(16)15(20)19-7-6-13-12(8-19)14(21-18-13)10-2-4-11(17)5-3-10/h2-5,9H,6-8H2,1H3 |
| InChIKey | OLBPTRDEWGCRIL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|