C16H21N5O6 — CID 11463094
5-(aziridin-1-yl)-N-methyl-N-(2-morpholin-4-ylethyl)-2,4-dinitrobenzamide (PubChem CID 11463094) has the molecular formula C16H21N5O6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 5-(aziridin-1-yl)-N-methyl-N-(2-morpholin-4-ylethyl)-2,4-dinitrobenzamide.
| Compound Name | 5-(aziridin-1-yl)-N-methyl-N-(2-morpholin-4-ylethyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 11463094 |
| Molecular Formula | C16H21N5O6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-(aziridin-1-yl)-N-methyl-N-(2-morpholin-4-ylethyl)-2,4-dinitrobenzamide |
| SMILES | CN(CCN1CCOCC1)C(=O)c1cc(N2CC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N5O6/c1-17(2-3-18-6-8-27-9-7-18)16(22)12-10-14(19-4-5-19)15(21(25)26)11-13(12)20(23)24/h10-11H,2-9H2,1H3 |
| InChIKey | SNXLRYLQLHUCQN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 122.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|