C43H44ClN7O6S — CID 67227736
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]sulfonyl-2-(1H-indol-4-yloxy)benzamide (PubChem CID 67227736) has the molecular formula C43H44ClN7O6S and a molecular weight of 822.39 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]sulfonyl-2-(1H-indol-4-yloxy)benzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]sulfonyl-2-(1H-indol-4-yloxy)benzamide |
|---|---|
| PubChem CID | 67227736 |
| Molecular Formula | C43H44ClN7O6S |
| Molecular Weight | 822.39 g/mol |
| Exact Mass | 821.28 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[3-(dimethylamino)propylamino]-3-nitrophenyl]sulfonyl-2-(1H-indol-4-yloxy)benzamide |
| SMILES | CN(C)CCCNc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2Oc2cccc3[nH]ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C43H44ClN7O6S/c1-48(2)22-6-20-45-39-18-16-34(28-40(39)51(53)54)58(55,56)47-43(52)37-17-15-33(27-42(37)57-41-10-5-9-38-36(41)19-21-46-38)50-25-23-49(24-26-50)29-31-7-3-4-8-35(31)30-11-13-32(44)14-12-30/h3-5,7-19,21,27-28,45-46H,6,20,22-26,29H2,1-2H3,(H,47,52) |
| InChIKey | QMTNYDPEIMSBMG-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.39 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|