C42H44ClN7O7S — CID 67227748
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-pyridin-3-yloxybenzamide (PubChem CID 67227748) has the molecular formula C42H44ClN7O7S and a molecular weight of 826.38 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-pyridin-3-yloxybenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-pyridin-3-yloxybenzamide |
|---|---|
| PubChem CID | 67227748 |
| Molecular Formula | C42H44ClN7O7S |
| Molecular Weight | 826.38 g/mol |
| Exact Mass | 825.27 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-pyridin-3-yloxybenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCCN2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Oc1cccnc1 |
| InChI | InChI=1S/C42H44ClN7O7S/c43-33-10-8-31(9-11-33)37-7-2-1-5-32(37)30-48-19-21-49(22-20-48)34-12-14-38(41(27-34)57-35-6-3-16-44-29-35)42(51)46-58(54,55)36-13-15-39(40(28-36)50(52)53)45-17-4-18-47-23-25-56-26-24-47/h1-3,5-16,27-29,45H,4,17-26,30H2,(H,46,51) |
| InChIKey | VFRSNAQASXNCPC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.38 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|