C48H53ClN6O9S — CID 46235102
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[4-(2-morpholin-4-ylethoxy)phenoxy]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide (PubChem CID 46235102) has the molecular formula C48H53ClN6O9S and a molecular weight of 925.50 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[4-(2-morpholin-4-ylethoxy)phenoxy]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[4-(2-morpholin-4-ylethoxy)phenoxy]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 46235102 |
| Molecular Formula | C48H53ClN6O9S |
| Molecular Weight | 925.50 g/mol |
| Exact Mass | 924.33 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-2-[4-(2-morpholin-4-ylethoxy)phenoxy]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Oc1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C48H53ClN6O9S/c49-38-7-5-36(6-8-38)43-4-2-1-3-37(43)34-53-19-21-54(22-20-53)39-9-15-44(47(31-39)64-41-12-10-40(11-13-41)63-30-25-52-23-28-62-29-24-52)48(56)51-65(59,60)42-14-16-45(46(32-42)55(57)58)50-33-35-17-26-61-27-18-35/h1-16,31-32,35,50H,17-30,33-34H2,(H,51,56) |
| InChIKey | DLWPWHHSDVYXCO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|