C42H42ClN5O7S — CID 46831857
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide (PubChem CID 46831857) has the molecular formula C42H42ClN5O7S and a molecular weight of 796.35 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide |
|---|---|
| PubChem CID | 46831857 |
| Molecular Formula | C42H42ClN5O7S |
| Molecular Weight | 796.35 g/mol |
| Exact Mass | 795.25 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C42H42ClN5O7S/c43-33-12-10-31(11-13-33)37-9-5-4-6-32(37)29-46-20-22-47(23-21-46)34-14-16-38(41(26-34)55-35-7-2-1-3-8-35)42(49)45-56(52,53)36-15-17-39(40(27-36)48(50)51)44-28-30-18-24-54-25-19-30/h1-17,26-27,30,44H,18-25,28-29H2,(H,45,49) |
| InChIKey | UAGRFZKJJKZMPI-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.35 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|