C48H53ClN6O8S — CID 46830681
4-[4-[[2-(4-chlorophenyl)-5-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide (PubChem CID 46830681) has the molecular formula C48H53ClN6O8S and a molecular weight of 909.51 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)-5-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)-5-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide |
|---|---|
| PubChem CID | 46830681 |
| Molecular Formula | C48H53ClN6O8S |
| Molecular Weight | 909.51 g/mol |
| Exact Mass | 908.33 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)-5-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-phenoxybenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3cc(OCCN4CCCC4)ccc3-c3ccc(Cl)cc3)CC2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C48H53ClN6O8S/c49-38-10-8-36(9-11-38)43-16-13-41(62-29-26-52-20-4-5-21-52)30-37(43)34-53-22-24-54(25-23-53)39-12-15-44(47(31-39)63-40-6-2-1-3-7-40)48(56)51-64(59,60)42-14-17-45(46(32-42)55(57)58)50-33-35-18-27-61-28-19-35/h1-3,6-17,30-32,35,50H,4-5,18-29,33-34H2,(H,51,56) |
| InChIKey | IFYSCBSTYRSEKN-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.51 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|