C40H41ClN6O6S — CID 53261696
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[2-(dimethylamino)ethylamino]-3-nitrophenyl]sulfonyl-2-phenoxybenzamide (PubChem CID 53261696) has the molecular formula C40H41ClN6O6S and a molecular weight of 769.32 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[2-(dimethylamino)ethylamino]-3-nitrophenyl]sulfonyl-2-phenoxybenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[2-(dimethylamino)ethylamino]-3-nitrophenyl]sulfonyl-2-phenoxybenzamide |
|---|---|
| PubChem CID | 53261696 |
| Molecular Formula | C40H41ClN6O6S |
| Molecular Weight | 769.32 g/mol |
| Exact Mass | 768.25 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[2-(dimethylamino)ethylamino]-3-nitrophenyl]sulfonyl-2-phenoxybenzamide |
| SMILES | CN(C)CCNc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2Oc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C40H41ClN6O6S/c1-44(2)21-20-42-37-19-17-34(27-38(37)47(49)50)54(51,52)43-40(48)36-18-16-32(26-39(36)53-33-9-4-3-5-10-33)46-24-22-45(23-25-46)28-30-8-6-7-11-35(30)29-12-14-31(41)15-13-29/h3-19,26-27,42H,20-25,28H2,1-2H3,(H,43,48) |
| InChIKey | ACAPYGQFSJLDCS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.32 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|