C44H42ClN5O5S — CID 131976227
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-pyridin-2-yloxyethylamino)phenyl]sulfonyl-2-phenoxybenzamide (PubChem CID 131976227) has the molecular formula C44H42ClN5O5S and a molecular weight of 788.37 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-pyridin-2-yloxyethylamino)phenyl]sulfonyl-2-phenoxybenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-pyridin-2-yloxyethylamino)phenyl]sulfonyl-2-phenoxybenzamide |
|---|---|
| PubChem CID | 131976227 |
| Molecular Formula | C44H42ClN5O5S |
| Molecular Weight | 788.37 g/mol |
| Exact Mass | 787.26 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-pyridin-2-yloxyethylamino)phenyl]sulfonyl-2-phenoxybenzamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2Oc2ccccc2)ccc1NCCOc1ccccn1 |
| InChI | InChI=1S/C44H42ClN5O5S/c1-32-29-38(19-21-41(32)46-23-28-54-43-13-7-8-22-47-43)56(52,53)48-44(51)40-20-18-36(30-42(40)55-37-10-3-2-4-11-37)50-26-24-49(25-27-50)31-34-9-5-6-12-39(34)33-14-16-35(45)17-15-33/h2-22,29-30,46H,23-28,31H2,1H3,(H,48,51) |
| InChIKey | HRPGUXTTZQHKBL-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.37 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|