C39H38Cl2N4O3S2 — CID 131975627
4-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 131975627) has the molecular formula C39H38Cl2N4O3S2 and a molecular weight of 745.80 g/mol. Its IUPAC name is 4-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 131975627 |
| Molecular Formula | C39H38Cl2N4O3S2 |
| Molecular Weight | 745.80 g/mol |
| Exact Mass | 744.18 |
| IUPAC Name | 4-[4-[[2-(3,4-dichlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-methyl-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)c(Cl)c4)CC3)cc2)ccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C39H38Cl2N4O3S2/c1-28-25-34(16-18-38(28)42-19-24-49-33-8-3-2-4-9-33)50(47,48)43-39(46)29-11-14-32(15-12-29)45-22-20-44(21-23-45)27-31-7-5-6-10-35(31)30-13-17-36(40)37(41)26-30/h2-18,25-26,42H,19-24,27H2,1H3,(H,43,46) |
| InChIKey | RNSJZXLVDNCJRF-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.80 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|