C43H48ClN5O3S2 — CID 131976237
N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-methylphenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 131976237) has the molecular formula C43H48ClN5O3S2 and a molecular weight of 782.48 g/mol. Its IUPAC name is N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-methylphenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-methylphenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 131976237 |
| Molecular Formula | C43H48ClN5O3S2 |
| Molecular Weight | 782.48 g/mol |
| Exact Mass | 781.29 |
| IUPAC Name | N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-methylphenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2)ccc1N[C@H](CCCCN)CSc1ccccc1 |
| InChI | InChI=1S/C43H48ClN5O3S2/c1-32-29-40(22-23-42(32)46-37(10-7-8-24-45)31-53-39-11-3-2-4-12-39)54(51,52)47-43(50)34-16-20-38(21-17-34)49-27-25-48(26-28-49)30-35-9-5-6-13-41(35)33-14-18-36(44)19-15-33/h2-6,9,11-23,29,37,46H,7-8,10,24-28,30-31,45H2,1H3,(H,47,50)/t37-/m1/s1 |
| InChIKey | XLNLOGKUUXNXHG-DIPNUNPCSA-N |
| XLogP | 8.46 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.48 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|