C39H35ClF3N3O4S2 — CID 67069450
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(2-phenylsulfanylethoxy)-3-(trifluoromethyl)phenyl]sulfonylbenzamide (PubChem CID 67069450) has the molecular formula C39H35ClF3N3O4S2 and a molecular weight of 766.31 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(2-phenylsulfanylethoxy)-3-(trifluoromethyl)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(2-phenylsulfanylethoxy)-3-(trifluoromethyl)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67069450 |
| Molecular Formula | C39H35ClF3N3O4S2 |
| Molecular Weight | 766.31 g/mol |
| Exact Mass | 765.17 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-(2-phenylsulfanylethoxy)-3-(trifluoromethyl)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(OCCSc2ccccc2)c(C(F)(F)F)c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C39H35ClF3N3O4S2/c40-31-14-10-28(11-15-31)35-9-5-4-6-30(35)27-45-20-22-46(23-21-45)32-16-12-29(13-17-32)38(47)44-52(48,49)34-18-19-37(36(26-34)39(41,42)43)50-24-25-51-33-7-2-1-3-8-33/h1-19,26H,20-25,27H2,(H,44,47) |
| InChIKey | MFJRHOLIZYEXOV-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.31 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|