C32H33ClN4O5S2 — CID 131976456
N-(4-amino-3-ethylsulfonylphenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 131976456) has the molecular formula C32H33ClN4O5S2 and a molecular weight of 653.23 g/mol. Its IUPAC name is N-(4-amino-3-ethylsulfonylphenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-(4-amino-3-ethylsulfonylphenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 131976456 |
| Molecular Formula | C32H33ClN4O5S2 |
| Molecular Weight | 653.23 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | N-(4-amino-3-ethylsulfonylphenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | CCS(=O)(=O)c1cc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2)ccc1N |
| InChI | InChI=1S/C32H33ClN4O5S2/c1-2-43(39,40)31-21-28(15-16-30(31)34)44(41,42)35-32(38)24-9-13-27(14-10-24)37-19-17-36(18-20-37)22-25-5-3-4-6-29(25)23-7-11-26(33)12-8-23/h3-16,21H,2,17-20,22,34H2,1H3,(H,35,38) |
| InChIKey | DYHYXNRLJPRFJX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|