C31H28ClF3N4O5S2 — CID 131976472
N-[4-amino-3-(trifluoromethylsulfonyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 131976472) has the molecular formula C31H28ClF3N4O5S2 and a molecular weight of 693.17 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethylsulfonyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-amino-3-(trifluoromethylsulfonyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 131976472 |
| Molecular Formula | C31H28ClF3N4O5S2 |
| Molecular Weight | 693.17 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | N-[4-amino-3-(trifluoromethylsulfonyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C31H28ClF3N4O5S2/c32-24-9-5-21(6-10-24)27-4-2-1-3-23(27)20-38-15-17-39(18-16-38)25-11-7-22(8-12-25)30(40)37-46(43,44)26-13-14-28(36)29(19-26)45(41,42)31(33,34)35/h1-14,19H,15-18,20,36H2,(H,37,40) |
| InChIKey | RQNKSJUUISESHB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.17 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|