C31H27ClF4N4O3S — CID 131976296
N-[4-amino-2-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 131976296) has the molecular formula C31H27ClF4N4O3S and a molecular weight of 647.09 g/mol. Its IUPAC name is N-[4-amino-2-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-amino-2-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 131976296 |
| Molecular Formula | C31H27ClF4N4O3S |
| Molecular Weight | 647.09 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | N-[4-amino-2-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C31H27ClF4N4O3S/c32-23-9-5-20(6-10-23)25-4-2-1-3-22(25)19-39-15-17-40(18-16-39)24-11-7-21(8-12-24)30(41)38-44(42,43)27-14-13-26(37)28(29(27)33)31(34,35)36/h1-14H,15-19,37H2,(H,38,41) |
| InChIKey | HVWBLNFXNCEZTL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.09 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|