C30H28ClN3O3S — CID 174652747
benzene;4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-sulfonylbenzamide (PubChem CID 174652747) has the molecular formula C30H28ClN3O3S and a molecular weight of 546.09 g/mol. Its IUPAC name is benzene;4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-sulfonylbenzamide.
| Compound Name | benzene;4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-sulfonylbenzamide |
|---|---|
| PubChem CID | 174652747 |
| Molecular Formula | C30H28ClN3O3S |
| Molecular Weight | 546.09 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | benzene;4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-sulfonylbenzamide |
| SMILES | O=C(N=S(=O)=O)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1.c1ccccc1 |
| InChI | InChI=1S/C24H22ClN3O3S.C6H6/c25-21-9-5-18(6-10-21)23-4-2-1-3-20(23)17-27-13-15-28(16-14-27)22-11-7-19(8-12-22)24(29)26-32(30)31;1-2-4-6-5-3-1/h1-12H,13-17H2;1-6H |
| InChIKey | JHJCEGFJOKKUGQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.09 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |