C24H25ClN4 — CID 59186614
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzenecarboximidamide (PubChem CID 59186614) has the molecular formula C24H25ClN4 and a molecular weight of 404.95 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzenecarboximidamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 59186614 |
| Molecular Formula | C24H25ClN4 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H25ClN4/c25-21-9-5-18(6-10-21)23-4-2-1-3-20(23)17-28-13-15-29(16-14-28)22-11-7-19(8-12-22)24(26)27/h1-12H,13-17H2,(H3,26,27) |
| InChIKey | AMLQKSAWNVNXNU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|