C34H38ClN3O3S — CID 70695487
N-(1-adamantylsulfonyl)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 70695487) has the molecular formula C34H38ClN3O3S and a molecular weight of 604.22 g/mol. Its IUPAC name is N-(1-adamantylsulfonyl)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-(1-adamantylsulfonyl)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 70695487 |
| Molecular Formula | C34H38ClN3O3S |
| Molecular Weight | 604.22 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | N-(1-adamantylsulfonyl)-4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NS(=O)(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H38ClN3O3S/c35-30-9-5-27(6-10-30)32-4-2-1-3-29(32)23-37-13-15-38(16-14-37)31-11-7-28(8-12-31)33(39)36-42(40,41)34-20-24-17-25(21-34)19-26(18-24)22-34/h1-12,24-26H,13-23H2,(H,36,39) |
| InChIKey | OROHZFTYRMYNPK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.22 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |