C42H47ClFN5O7S — CID 165172220
4-[4-[[2-(4-chlorophenyl)piperidin-1-yl]methyl]piperidin-1-yl]-2-(3-fluorophenoxy)-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide (PubChem CID 165172220) has the molecular formula C42H47ClFN5O7S and a molecular weight of 820.38 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)piperidin-1-yl]methyl]piperidin-1-yl]-2-(3-fluorophenoxy)-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)piperidin-1-yl]methyl]piperidin-1-yl]-2-(3-fluorophenoxy)-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 165172220 |
| Molecular Formula | C42H47ClFN5O7S |
| Molecular Weight | 820.38 g/mol |
| Exact Mass | 819.29 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)piperidin-1-yl]methyl]piperidin-1-yl]-2-(3-fluorophenoxy)-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2CCOCC2)c([N+](=O)[O-])c1)c1ccc(N2CCC(CN3CCCCC3c3ccc(Cl)cc3)CC2)cc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C42H47ClFN5O7S/c43-32-9-7-31(8-10-32)39-6-1-2-19-48(39)28-30-15-20-47(21-16-30)34-11-13-37(41(25-34)56-35-5-3-4-33(44)24-35)42(50)46-57(53,54)36-12-14-38(40(26-36)49(51)52)45-27-29-17-22-55-23-18-29/h3-5,7-14,24-26,29-30,39,45H,1-2,6,15-23,27-28H2,(H,46,50) |
| InChIKey | ZKWKFEMKBYJVAR-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.38 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|