C38H50N6O9S2 — CID 178112821
N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-(piperidin-1-ylmethyl)piperidin-1-yl]-2-[(5-propan-2-ylsulfonyl-3-pyridinyl)oxy]benzamide (PubChem CID 178112821) has the molecular formula C38H50N6O9S2 and a molecular weight of 798.98 g/mol. Its IUPAC name is N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-(piperidin-1-ylmethyl)piperidin-1-yl]-2-[(5-propan-2-ylsulfonyl-3-pyridinyl)oxy]benzamide.
| Compound Name | N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-(piperidin-1-ylmethyl)piperidin-1-yl]-2-[(5-propan-2-ylsulfonyl-3-pyridinyl)oxy]benzamide |
|---|---|
| PubChem CID | 178112821 |
| Molecular Formula | C38H50N6O9S2 |
| Molecular Weight | 798.98 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-(piperidin-1-ylmethyl)piperidin-1-yl]-2-[(5-propan-2-ylsulfonyl-3-pyridinyl)oxy]benzamide |
| SMILES | CC(C)S(=O)(=O)c1cncc(Oc2cc(N3CCC(CN4CCCCC4)CC3)ccc2C(=O)NS(=O)(=O)c2ccc(NCC3CCOCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C38H50N6O9S2/c1-27(2)54(48,49)33-21-31(24-39-25-33)53-37-20-30(43-16-10-29(11-17-43)26-42-14-4-3-5-15-42)6-8-34(37)38(45)41-55(50,51)32-7-9-35(36(22-32)44(46)47)40-23-28-12-18-52-19-13-28/h6-9,20-22,24-25,27-29,40H,3-5,10-19,23,26H2,1-2H3,(H,41,45) |
| InChIKey | SHCXJLRUQAWZPW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 190.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.98 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|