C17H26N4O6S — CID 124565254
tert-butyl (3R)-3-[(2-nitro-4-sulfamoylanilino)methyl]piperidine-1-carboxylate (PubChem CID 124565254) has the molecular formula C17H26N4O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(2-nitro-4-sulfamoylanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(2-nitro-4-sulfamoylanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124565254 |
| Molecular Formula | C17H26N4O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | tert-butyl (3R)-3-[(2-nitro-4-sulfamoylanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H26N4O6S/c1-17(2,3)27-16(22)20-8-4-5-12(11-20)10-19-14-7-6-13(28(18,25)26)9-15(14)21(23)24/h6-7,9,12,19H,4-5,8,10-11H2,1-3H3,(H2,18,25,26)/t12-/m1/s1 |
| InChIKey | ZUERCDNDNOTPJR-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|