C17H23Cl3N2O2 — CID 113256271
tert-butyl 3-[(2,4,5-trichloroanilino)methyl]piperidine-1-carboxylate (PubChem CID 113256271) has the molecular formula C17H23Cl3N2O2 and a molecular weight of 393.74 g/mol. Its IUPAC name is tert-butyl 3-[(2,4,5-trichloroanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2,4,5-trichloroanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113256271 |
| Molecular Formula | C17H23Cl3N2O2 |
| Molecular Weight | 393.74 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | tert-butyl 3-[(2,4,5-trichloroanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H23Cl3N2O2/c1-17(2,3)24-16(23)22-6-4-5-11(10-22)9-21-15-8-13(19)12(18)7-14(15)20/h7-8,11,21H,4-6,9-10H2,1-3H3 |
| InChIKey | YPJSGSCIKMEWPB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.74 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|