C20H32ClN3O3 — CID 168638386
tert-butyl 3-[[4-[(3-chloro-2-hydroxypropyl)amino]anilino]methyl]piperidine-1-carboxylate (PubChem CID 168638386) has the molecular formula C20H32ClN3O3 and a molecular weight of 397.95 g/mol. Its IUPAC name is tert-butyl 3-[[4-[(3-chloro-2-hydroxypropyl)amino]anilino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[(3-chloro-2-hydroxypropyl)amino]anilino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168638386 |
| Molecular Formula | C20H32ClN3O3 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | tert-butyl 3-[[4-[(3-chloro-2-hydroxypropyl)amino]anilino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2ccc(NCC(O)CCl)cc2)C1 |
| InChI | InChI=1S/C20H32ClN3O3/c1-20(2,3)27-19(26)24-10-4-5-15(14-24)12-22-16-6-8-17(9-7-16)23-13-18(25)11-21/h6-9,15,18,22-23,25H,4-5,10-14H2,1-3H3 |
| InChIKey | PNSGUFZDEKDNPH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|