C17H24ClFN2O2 — CID 107364244
tert-butyl 3-[(3-chloro-5-fluoroanilino)methyl]piperidine-1-carboxylate (PubChem CID 107364244) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is tert-butyl 3-[(3-chloro-5-fluoroanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-chloro-5-fluoroanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107364244 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | tert-butyl 3-[(3-chloro-5-fluoroanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C17H24ClFN2O2/c1-17(2,3)23-16(22)21-6-4-5-12(11-21)10-20-15-8-13(18)7-14(19)9-15/h7-9,12,20H,4-6,10-11H2,1-3H3 |
| InChIKey | UBUNDMPKGHDQTB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |