C17H24BrN3O4 — CID 113343346
tert-butyl 3-[(3-bromo-4-nitroanilino)methyl]piperidine-1-carboxylate (PubChem CID 113343346) has the molecular formula C17H24BrN3O4 and a molecular weight of 414.30 g/mol. Its IUPAC name is tert-butyl 3-[(3-bromo-4-nitroanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-bromo-4-nitroanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113343346 |
| Molecular Formula | C17H24BrN3O4 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | tert-butyl 3-[(3-bromo-4-nitroanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2ccc([N+](=O)[O-])c(Br)c2)C1 |
| InChI | InChI=1S/C17H24BrN3O4/c1-17(2,3)25-16(22)20-8-4-5-12(11-20)10-19-13-6-7-15(21(23)24)14(18)9-13/h6-7,9,12,19H,4-5,8,10-11H2,1-3H3 |
| InChIKey | BRGFOVVLOGMQIV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|