C17H26N4O4S — CID 134318141
tert-butyl 4-[(4-aminosulfanyl-2-nitroanilino)methyl]piperidine-1-carboxylate (PubChem CID 134318141) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is tert-butyl 4-[(4-aminosulfanyl-2-nitroanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-aminosulfanyl-2-nitroanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134318141 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | tert-butyl 4-[(4-aminosulfanyl-2-nitroanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2ccc(SN)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26N4O4S/c1-17(2,3)25-16(22)20-8-6-12(7-9-20)11-19-14-5-4-13(26-18)10-15(14)21(23)24/h4-5,10,12,19H,6-9,11,18H2,1-3H3 |
| InChIKey | WXGWPSJCSJJLGH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|